C6H9N3S — CID 58313047
5-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 58313047) has the molecular formula C6H9N3S and a molecular weight of 155.23 g/mol. Its IUPAC name is 5-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 58313047 |
| Molecular Formula | C6H9N3S |
| Molecular Weight | 155.23 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 5-cyclopropyl-N-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | CNc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C6H9N3S/c1-7-6-9-8-5(10-6)4-2-3-4/h4H,2-3H2,1H3,(H,7,9) |
| InChIKey | IXHHQNQBJBSEFT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |