About (1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol
(1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol (PubChem CID 163638061) has the molecular formula C7H11N3OS
and a molecular weight of 185.25 g/mol. Its IUPAC name is (1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol.
Molecular Properties
| Compound Name | (1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol |
| PubChem CID | 163638061 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | (1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol |
| SMILES | C[C@H](O)Nc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C7H11N3OS/c1-4(11)8-7-10-9-6(12-7)5-2-3-5/h4-5,11H,2-3H2,1H3,(H,8,10)/t4-/m0/s1 |
| InChIKey | IBXCSWBDQATPAW-BYPYZUCNSA-N |
| XLogP | 1.17 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol?
The IUPAC name of (1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol (CID 163638061) is (1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol.
What is the SMILES notation for (1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol?
The canonical SMILES for (1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol is C[C@H](O)Nc1nnc(C2CC2)s1.
What is the InChIKey of (1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol?
The InChIKey is IBXCSWBDQATPAW-BYPYZUCNSA-N. The full InChI is InChI=1S/C7H11N3OS/c1-4(11)8-7-10-9-6(12-7)5-2-3-5/h4-5,11H,2-3H2,1H3,(H,8,10)/t4-/m0/s1.
What are the key properties of (1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol?
(1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol has a molecular weight of 185.25 g/mol, XLogP of 1.17, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]ethanol is sourced from PubChem (CID 163638061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).