C11H12N6O2S2 — CID 138478455
N-[5-[(1S,3S)-3-(5-formamido-1,3,4-thiadiazol-2-yl)cyclopentyl]-1,3,4-thiadiazol-2-yl]formamide (PubChem CID 138478455) has the molecular formula C11H12N6O2S2 and a molecular weight of 324.39 g/mol. Its IUPAC name is N-[5-[(1S,3S)-3-(5-formamido-1,3,4-thiadiazol-2-yl)cyclopentyl]-1,3,4-thiadiazol-2-yl]formamide.
| Compound Name | N-[5-[(1S,3S)-3-(5-formamido-1,3,4-thiadiazol-2-yl)cyclopentyl]-1,3,4-thiadiazol-2-yl]formamide |
|---|---|
| PubChem CID | 138478455 |
| Molecular Formula | C11H12N6O2S2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | N-[5-[(1S,3S)-3-(5-formamido-1,3,4-thiadiazol-2-yl)cyclopentyl]-1,3,4-thiadiazol-2-yl]formamide |
| SMILES | O=CNc1nnc([C@H]2CC[C@H](c3nnc(NC=O)s3)C2)s1 |
| InChI | InChI=1S/C11H12N6O2S2/c18-4-12-10-16-14-8(20-10)6-1-2-7(3-6)9-15-17-11(21-9)13-5-19/h4-7H,1-3H2,(H,12,16,18)(H,13,17,19)/t6-,7-/m0/s1 |
| InChIKey | RVBPITOPULHTAM-BQBZGAKWSA-N |
| XLogP | 1.58 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|