C16H20N6O2S — CID 129135973
N-[6-[(5R)-5-(5-formamido-1,3,4-thiadiazol-2-yl)-2,4-dimethylcyclohexyl]pyridazin-3-yl]formamide (PubChem CID 129135973) has the molecular formula C16H20N6O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-[6-[(5R)-5-(5-formamido-1,3,4-thiadiazol-2-yl)-2,4-dimethylcyclohexyl]pyridazin-3-yl]formamide.
| Compound Name | N-[6-[(5R)-5-(5-formamido-1,3,4-thiadiazol-2-yl)-2,4-dimethylcyclohexyl]pyridazin-3-yl]formamide |
|---|---|
| PubChem CID | 129135973 |
| Molecular Formula | C16H20N6O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-[6-[(5R)-5-(5-formamido-1,3,4-thiadiazol-2-yl)-2,4-dimethylcyclohexyl]pyridazin-3-yl]formamide |
| SMILES | CC1CC(C)[C@H](c2nnc(NC=O)s2)CC1c1ccc(NC=O)nn1 |
| InChI | InChI=1S/C16H20N6O2S/c1-9-5-10(2)12(15-21-22-16(25-15)18-8-24)6-11(9)13-3-4-14(17-7-23)20-19-13/h3-4,7-12H,5-6H2,1-2H3,(H,17,20,23)(H,18,22,24)/t9?,10?,11?,12-/m1/s1 |
| InChIKey | OMNJNBOUQHMPLW-XHUCQOSOSA-N |
| XLogP | 2.40 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|