C11H13N7OS2 — CID 144630567
N-[5-[(1R,3R)-3-[5-[(Z)-aminomethylideneamino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]formamide (PubChem CID 144630567) has the molecular formula C11H13N7OS2 and a molecular weight of 323.41 g/mol. Its IUPAC name is N-[5-[(1R,3R)-3-[5-[(Z)-aminomethylideneamino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]formamide.
| Compound Name | N-[5-[(1R,3R)-3-[5-[(Z)-aminomethylideneamino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]formamide |
|---|---|
| PubChem CID | 144630567 |
| Molecular Formula | C11H13N7OS2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-[5-[(1R,3R)-3-[5-[(Z)-aminomethylideneamino]-1,3,4-thiadiazol-2-yl]cyclopentyl]-1,3,4-thiadiazol-2-yl]formamide |
| SMILES | N/C=N\c1nnc([C@@H]2CC[C@@H](c3nnc(NC=O)s3)C2)s1 |
| InChI | InChI=1S/C11H13N7OS2/c12-4-13-10-17-15-8(20-10)6-1-2-7(3-6)9-16-18-11(21-9)14-5-19/h4-7H,1-3H2,(H2,12,13,17)(H,14,18,19)/t6-,7-/m1/s1 |
| InChIKey | QJMZOQKXVMNXTG-RNFRBKRXSA-N |
| XLogP | 1.63 |
| TPSA | 119.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|