C10H11N7O2S2 — CID 134305638
N-[5-[(2S,4S)-4-(5-formamido-1,3,4-thiadiazol-2-yl)-1-methylazetidin-2-yl]-1,3,4-thiadiazol-2-yl]formamide (PubChem CID 134305638) has the molecular formula C10H11N7O2S2 and a molecular weight of 325.38 g/mol. Its IUPAC name is N-[5-[(2S,4S)-4-(5-formamido-1,3,4-thiadiazol-2-yl)-1-methylazetidin-2-yl]-1,3,4-thiadiazol-2-yl]formamide.
| Compound Name | N-[5-[(2S,4S)-4-(5-formamido-1,3,4-thiadiazol-2-yl)-1-methylazetidin-2-yl]-1,3,4-thiadiazol-2-yl]formamide |
|---|---|
| PubChem CID | 134305638 |
| Molecular Formula | C10H11N7O2S2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-[5-[(2S,4S)-4-(5-formamido-1,3,4-thiadiazol-2-yl)-1-methylazetidin-2-yl]-1,3,4-thiadiazol-2-yl]formamide |
| SMILES | CN1[C@H](c2nnc(NC=O)s2)C[C@H]1c1nnc(NC=O)s1 |
| InChI | InChI=1S/C10H11N7O2S2/c1-17-5(7-13-15-9(20-7)11-3-18)2-6(17)8-14-16-10(21-8)12-4-19/h3-6H,2H2,1H3,(H,11,15,18)(H,12,16,19)/t5-,6-/m0/s1 |
| InChIKey | GOJZEZUFFLRPKZ-WDSKDSINSA-N |
| XLogP | 0.64 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|