C10H12N4O2S3 — CID 167939499
2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]ethanesulfonamide (PubChem CID 167939499) has the molecular formula C10H12N4O2S3 and a molecular weight of 316.43 g/mol. Its IUPAC name is 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]ethanesulfonamide.
| Compound Name | 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]ethanesulfonamide |
|---|---|
| PubChem CID | 167939499 |
| Molecular Formula | C10H12N4O2S3 |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCSc1nnc(Nc2ccccc2)s1 |
| InChI | InChI=1S/C10H12N4O2S3/c11-19(15,16)7-6-17-10-14-13-9(18-10)12-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13)(H2,11,15,16) |
| InChIKey | IWRDQOMWXIKTJX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |