C18H17N3OS2 — CID 2107142
4-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-phenylbutan-1-one (PubChem CID 2107142) has the molecular formula C18H17N3OS2 and a molecular weight of 355.49 g/mol. Its IUPAC name is 4-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-phenylbutan-1-one.
| Compound Name | 4-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 2107142 |
| Molecular Formula | C18H17N3OS2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 4-[(5-anilino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-phenylbutan-1-one |
| SMILES | O=C(CCCSc1nnc(Nc2ccccc2)s1)c1ccccc1 |
| InChI | InChI=1S/C18H17N3OS2/c22-16(14-8-3-1-4-9-14)12-7-13-23-18-21-20-17(24-18)19-15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2,(H,19,20) |
| InChIKey | UPTJZSPFSAMQKA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|