C12H12N2OS2 — CID 43413986
1-phenyl-4-(1,3,4-thiadiazol-2-ylsulfanyl)butan-1-one (PubChem CID 43413986) has the molecular formula C12H12N2OS2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 1-phenyl-4-(1,3,4-thiadiazol-2-ylsulfanyl)butan-1-one.
| Compound Name | 1-phenyl-4-(1,3,4-thiadiazol-2-ylsulfanyl)butan-1-one |
|---|---|
| PubChem CID | 43413986 |
| Molecular Formula | C12H12N2OS2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 1-phenyl-4-(1,3,4-thiadiazol-2-ylsulfanyl)butan-1-one |
| SMILES | O=C(CCCSc1nncs1)c1ccccc1 |
| InChI | InChI=1S/C12H12N2OS2/c15-11(10-5-2-1-3-6-10)7-4-8-16-12-14-13-9-17-12/h1-3,5-6,9H,4,7-8H2 |
| InChIKey | LVQJQDOBZQMHKM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|