C7H10N2O2S2 — CID 28971695
5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoic acid (PubChem CID 28971695) has the molecular formula C7H10N2O2S2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoic acid.
| Compound Name | 5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoic acid |
|---|---|
| PubChem CID | 28971695 |
| Molecular Formula | C7H10N2O2S2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoic acid |
| SMILES | O=C(O)CCCCSc1nncs1 |
| InChI | InChI=1S/C7H10N2O2S2/c10-6(11)3-1-2-4-12-7-9-8-5-13-7/h5H,1-4H2,(H,10,11) |
| InChIKey | CXWHRWQYQYBWQL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|