C20H20BrN3OS2 — CID 2399067
1-(4-bromophenyl)-4-[[5-(2,6-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-1-one (PubChem CID 2399067) has the molecular formula C20H20BrN3OS2 and a molecular weight of 462.44 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-[[5-(2,6-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-1-one.
| Compound Name | 1-(4-bromophenyl)-4-[[5-(2,6-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 2399067 |
| Molecular Formula | C20H20BrN3OS2 |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 1-(4-bromophenyl)-4-[[5-(2,6-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-1-one |
| SMILES | Cc1cccc(C)c1Nc1nnc(SCCCC(=O)c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C20H20BrN3OS2/c1-13-5-3-6-14(2)18(13)22-19-23-24-20(27-19)26-12-4-7-17(25)15-8-10-16(21)11-9-15/h3,5-6,8-11H,4,7,12H2,1-2H3,(H,22,23) |
| InChIKey | QOJDYQCSUDOAPK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|