C15H18FN3OS2 — CID 2501781
1-(4-fluorophenyl)-4-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-1-one (PubChem CID 2501781) has the molecular formula C15H18FN3OS2 and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-1-one.
| Compound Name | 1-(4-fluorophenyl)-4-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 2501781 |
| Molecular Formula | C15H18FN3OS2 |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butan-1-one |
| SMILES | CC(C)Nc1nnc(SCCCC(=O)c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C15H18FN3OS2/c1-10(2)17-14-18-19-15(22-14)21-9-3-4-13(20)11-5-7-12(16)8-6-11/h5-8,10H,3-4,9H2,1-2H3,(H,17,18) |
| InChIKey | YFBPNVFZFUXQEP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|