C17H17N3OS3 — CID 7855233
4-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-thiophen-2-ylbutan-1-one (PubChem CID 7855233) has the molecular formula C17H17N3OS3 and a molecular weight of 375.54 g/mol. Its IUPAC name is 4-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 7855233 |
| Molecular Formula | C17H17N3OS3 |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 4-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCSc1nnc(NCc2ccccc2)s1)c1cccs1 |
| InChI | InChI=1S/C17H17N3OS3/c21-14(15-9-5-10-22-15)8-4-11-23-17-20-19-16(24-17)18-12-13-6-2-1-3-7-13/h1-3,5-7,9-10H,4,8,11-12H2,(H,18,19) |
| InChIKey | MOWREMQYHMICFD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|