C10H11N3OS3 — CID 7760136
4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-thiophen-2-ylbutan-1-one (PubChem CID 7760136) has the molecular formula C10H11N3OS3 and a molecular weight of 285.42 g/mol. Its IUPAC name is 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 7760136 |
| Molecular Formula | C10H11N3OS3 |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-thiophen-2-ylbutan-1-one |
| SMILES | Nc1nnc(SCCCC(=O)c2cccs2)s1 |
| InChI | InChI=1S/C10H11N3OS3/c11-9-12-13-10(17-9)16-6-1-3-7(14)8-4-2-5-15-8/h2,4-5H,1,3,6H2,(H2,11,12) |
| InChIKey | JJOOUKFVZXNJKU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|