C14H13FOS2 — CID 43411995
4-(2-fluorophenyl)sulfanyl-1-thiophen-2-ylbutan-1-one (PubChem CID 43411995) has the molecular formula C14H13FOS2 and a molecular weight of 280.39 g/mol. Its IUPAC name is 4-(2-fluorophenyl)sulfanyl-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-(2-fluorophenyl)sulfanyl-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 43411995 |
| Molecular Formula | C14H13FOS2 |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 4-(2-fluorophenyl)sulfanyl-1-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCSc1ccccc1F)c1cccs1 |
| InChI | InChI=1S/C14H13FOS2/c15-11-5-1-2-7-13(11)17-9-3-6-12(16)14-8-4-10-18-14/h1-2,4-5,7-8,10H,3,6,9H2 |
| InChIKey | HHIBILGRXBJBFC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|