C18H16ClN5O3 — CID 7593564
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(4-chlorophenoxy)acetate (PubChem CID 7593564) has the molecular formula C18H16ClN5O3 and a molecular weight of 385.81 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(4-chlorophenoxy)acetate.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 7593564 |
| Molecular Formula | C18H16ClN5O3 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(4-chlorophenoxy)acetate |
| SMILES | Nc1nc(COC(=O)COc2ccc(Cl)cc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C18H16ClN5O3/c19-12-6-8-14(9-7-12)26-11-16(25)27-10-15-22-17(20)24-18(23-15)21-13-4-2-1-3-5-13/h1-9H,10-11H2,(H3,20,21,22,23,24) |
| InChIKey | RSCNFRNKSZJQTH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |