C12H13N5O3 — CID 9416576
(4,6-diamino-1,3,5-triazin-2-yl)methyl 2-phenoxyacetate (PubChem CID 9416576) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-phenoxyacetate.
| Compound Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-phenoxyacetate |
|---|---|
| PubChem CID | 9416576 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-phenoxyacetate |
| SMILES | Nc1nc(N)nc(COC(=O)COc2ccccc2)n1 |
| InChI | InChI=1S/C12H13N5O3/c13-11-15-9(16-12(14)17-11)6-20-10(18)7-19-8-4-2-1-3-5-8/h1-5H,6-7H2,(H4,13,14,15,16,17) |
| InChIKey | PEQAKDVNJPTMBA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 126.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |