C20H21N5O4 — CID 7593801
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(4-ethoxyphenoxy)acetate (PubChem CID 7593801) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(4-ethoxyphenoxy)acetate.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(4-ethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7593801 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(4-ethoxyphenoxy)acetate |
| SMILES | CCOc1ccc(OCC(=O)OCc2nc(N)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H21N5O4/c1-2-27-15-8-10-16(11-9-15)28-13-18(26)29-12-17-23-19(21)25-20(24-17)22-14-6-4-3-5-7-14/h3-11H,2,12-13H2,1H3,(H3,21,22,23,24,25) |
| InChIKey | IOLYFGQNEQOTMZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |