C18H15Cl2N5O2 — CID 7593484
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(3,4-dichlorophenyl)acetate (PubChem CID 7593484) has the molecular formula C18H15Cl2N5O2 and a molecular weight of 404.26 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(3,4-dichlorophenyl)acetate.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(3,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 7593484 |
| Molecular Formula | C18H15Cl2N5O2 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(3,4-dichlorophenyl)acetate |
| SMILES | Nc1nc(COC(=O)Cc2ccc(Cl)c(Cl)c2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C18H15Cl2N5O2/c19-13-7-6-11(8-14(13)20)9-16(26)27-10-15-23-17(21)25-18(24-15)22-12-4-2-1-3-5-12/h1-8H,9-10H2,(H3,21,22,23,24,25) |
| InChIKey | MFPOBNWJDQRQBI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |