C20H18N6O2 — CID 7593328
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(1H-indol-3-yl)acetate (PubChem CID 7593328) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(1H-indol-3-yl)acetate.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 7593328 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 2-(1H-indol-3-yl)acetate |
| SMILES | Nc1nc(COC(=O)Cc2c[nH]c3ccccc23)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C20H18N6O2/c21-19-24-17(25-20(26-19)23-14-6-2-1-3-7-14)12-28-18(27)10-13-11-22-16-9-5-4-8-15(13)16/h1-9,11,22H,10,12H2,(H3,21,23,24,25,26) |
| InChIKey | PSSHDQKKZBBUBO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |