C18H16ClN5O2 — CID 7614620
[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 2-chlorobenzoate (PubChem CID 7614620) has the molecular formula C18H16ClN5O2 and a molecular weight of 369.81 g/mol. Its IUPAC name is [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 2-chlorobenzoate.
| Compound Name | [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 2-chlorobenzoate |
|---|---|
| PubChem CID | 7614620 |
| Molecular Formula | C18H16ClN5O2 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 2-chlorobenzoate |
| SMILES | Cc1ccc(Nc2nc(N)nc(COC(=O)c3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C18H16ClN5O2/c1-11-6-8-12(9-7-11)21-18-23-15(22-17(20)24-18)10-26-16(25)13-4-2-3-5-14(13)19/h2-9H,10H2,1H3,(H3,20,21,22,23,24) |
| InChIKey | HPWXAEWCIKUMSB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |