C18H18N6O2 — CID 7614398
2-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methoxy]benzamide (PubChem CID 7614398) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methoxy]benzamide.
| Compound Name | 2-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 7614398 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methoxy]benzamide |
| SMILES | Cc1ccc(Nc2nc(N)nc(COc3ccccc3C(N)=O)n2)cc1 |
| InChI | InChI=1S/C18H18N6O2/c1-11-6-8-12(9-7-11)21-18-23-15(22-17(20)24-18)10-26-14-5-3-2-4-13(14)16(19)25/h2-9H,10H2,1H3,(H2,19,25)(H3,20,21,22,23,24) |
| InChIKey | KCTHMKDKISTRHO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |