C22H25N5O4 — CID 7631826
[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 4-(4-methoxyphenoxy)butanoate (PubChem CID 7631826) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 4-(4-methoxyphenoxy)butanoate.
| Compound Name | [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 4-(4-methoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 7631826 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 4-(4-methoxyphenoxy)butanoate |
| SMILES | COc1ccc(OCCCC(=O)OCc2nc(N)nc(Nc3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C22H25N5O4/c1-15-5-7-16(8-6-15)24-22-26-19(25-21(23)27-22)14-31-20(28)4-3-13-30-18-11-9-17(29-2)10-12-18/h5-12H,3-4,13-14H2,1-2H3,(H3,23,24,25,26,27) |
| InChIKey | UEHDTRBOEVJOMM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|