C23H22N6O4 — CID 27549295
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 27549295) has the molecular formula C23H22N6O4 and a molecular weight of 446.47 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 27549295 |
| Molecular Formula | C23H22N6O4 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)OCc1nc(N)nc(Nc3ccccc3)n1)C2=O |
| InChI | InChI=1S/C23H22N6O4/c1-14-9-10-16-17(12-14)21(32)29(20(16)31)11-5-8-19(30)33-13-18-26-22(24)28-23(27-18)25-15-6-3-2-4-7-15/h2-4,6-7,9-10,12H,5,8,11,13H2,1H3,(H3,24,25,26,27,28) |
| InChIKey | ZJQSQHAVKFUZJY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 140.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|