C21H22N6O3 — CID 22108401
[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 3-benzamidopropanoate (PubChem CID 22108401) has the molecular formula C21H22N6O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 3-benzamidopropanoate.
| Compound Name | [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 3-benzamidopropanoate |
|---|---|
| PubChem CID | 22108401 |
| Molecular Formula | C21H22N6O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 3-benzamidopropanoate |
| SMILES | Cc1ccc(Nc2nc(N)nc(COC(=O)CCNC(=O)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H22N6O3/c1-14-7-9-16(10-8-14)24-21-26-17(25-20(22)27-21)13-30-18(28)11-12-23-19(29)15-5-3-2-4-6-15/h2-10H,11-13H2,1H3,(H,23,29)(H3,22,24,25,26,27) |
| InChIKey | XWFOKGCURQBMOR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |