C19H20N2O4S — CID 35601337
(2-ethyl-1,3-thiazol-4-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 35601337) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is (2-ethyl-1,3-thiazol-4-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | (2-ethyl-1,3-thiazol-4-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 35601337 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (2-ethyl-1,3-thiazol-4-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | CCc1nc(COC(=O)CCCN2C(=O)c3ccc(C)cc3C2=O)cs1 |
| InChI | InChI=1S/C19H20N2O4S/c1-3-16-20-13(11-26-16)10-25-17(22)5-4-8-21-18(23)14-7-6-12(2)9-15(14)19(21)24/h6-7,9,11H,3-5,8,10H2,1-2H3 |
| InChIKey | NRJCVAHQLBFCST-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|