C21H18N2O5S — CID 35463053
(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 35463053) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 35463053 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-(5-methyl-1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)OCc1cc(-c3cccs3)on1)C2=O |
| InChI | InChI=1S/C21H18N2O5S/c1-13-6-7-15-16(10-13)21(26)23(20(15)25)8-2-5-19(24)27-12-14-11-17(28-22-14)18-4-3-9-29-18/h3-4,6-7,9-11H,2,5,8,12H2,1H3 |
| InChIKey | VZTJVJCAUDVTAT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|