C23H26N2O2 — CID 144909274
propane;5,7,8-trimethyl-2-[(E)-2-(3-nitrophenyl)ethenyl]quinoline (PubChem CID 144909274) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is propane;5,7,8-trimethyl-2-[(E)-2-(3-nitrophenyl)ethenyl]quinoline.
| Compound Name | propane;5,7,8-trimethyl-2-[(E)-2-(3-nitrophenyl)ethenyl]quinoline |
|---|---|
| PubChem CID | 144909274 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | propane;5,7,8-trimethyl-2-[(E)-2-(3-nitrophenyl)ethenyl]quinoline |
| SMILES | CCC.Cc1cc(C)c2ccc(/C=C/c3cccc([N+](=O)[O-])c3)nc2c1C |
| InChI | InChI=1S/C20H18N2O2.C3H8/c1-13-11-14(2)19-10-9-17(21-20(19)15(13)3)8-7-16-5-4-6-18(12-16)22(23)24;1-3-2/h4-12H,1-3H3;3H2,1-2H3/b8-7+; |
| InChIKey | XPGIXWGNOLSYHJ-USRGLUTNSA-N |
| XLogP | 6.65 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|