C29H24N4O4 — CID 102327818
N,N'-bis[4-[(E)-2-(3-nitrophenyl)ethenyl]phenyl]methanediamine (PubChem CID 102327818) has the molecular formula C29H24N4O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is N,N'-bis[4-[(E)-2-(3-nitrophenyl)ethenyl]phenyl]methanediamine.
| Compound Name | N,N'-bis[4-[(E)-2-(3-nitrophenyl)ethenyl]phenyl]methanediamine |
|---|---|
| PubChem CID | 102327818 |
| Molecular Formula | C29H24N4O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | N,N'-bis[4-[(E)-2-(3-nitrophenyl)ethenyl]phenyl]methanediamine |
| SMILES | O=[N+]([O-])c1cccc(/C=C/c2ccc(NCNc3ccc(/C=C/c4cccc([N+](=O)[O-])c4)cc3)cc2)c1 |
| InChI | InChI=1S/C29H24N4O4/c34-32(35)28-5-1-3-24(19-28)9-7-22-11-15-26(16-12-22)30-21-31-27-17-13-23(14-18-27)8-10-25-4-2-6-29(20-25)33(36)37/h1-20,30-31H,21H2/b9-7+,10-8+ |
| InChIKey | UJKTVTNVUOPTQY-FIFLTTCUSA-N |
| XLogP | 7.33 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|