C17H17F3N4O2 — CID 101079120
N,N-diethyl-4-[(4-nitrophenyl)diazenyl]-2-(trifluoromethyl)aniline (PubChem CID 101079120) has the molecular formula C17H17F3N4O2 and a molecular weight of 366.34 g/mol. Its IUPAC name is N,N-diethyl-4-[(4-nitrophenyl)diazenyl]-2-(trifluoromethyl)aniline.
| Compound Name | N,N-diethyl-4-[(4-nitrophenyl)diazenyl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 101079120 |
| Molecular Formula | C17H17F3N4O2 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N,N-diethyl-4-[(4-nitrophenyl)diazenyl]-2-(trifluoromethyl)aniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H17F3N4O2/c1-3-23(4-2)16-10-7-13(11-15(16)17(18,19)20)22-21-12-5-8-14(9-6-12)24(25)26/h5-11H,3-4H2,1-2H3/b22-21+ |
| InChIKey | DGLKQZZRZHASCU-QURGRASLSA-N |
| XLogP | 5.88 |
| TPSA | 71.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|