C30H36N8O10S4 — CID 18335350
5-[[2-[[3-tert-butyl-4-cyano-1-(1,3-thiazol-2-yl)pyrazol-5-yl]diazenyl]-5-[ethyl(4-sulfobutyl)amino]anilino]methoxy]benzene-1,3-disulfonic acid (PubChem CID 18335350) has the molecular formula C30H36N8O10S4 and a molecular weight of 796.93 g/mol. Its IUPAC name is 5-[[2-[[3-tert-butyl-4-cyano-1-(1,3-thiazol-2-yl)pyrazol-5-yl]diazenyl]-5-[ethyl(4-sulfobutyl)amino]anilino]methoxy]benzene-1,3-disulfonic acid.
| Compound Name | 5-[[2-[[3-tert-butyl-4-cyano-1-(1,3-thiazol-2-yl)pyrazol-5-yl]diazenyl]-5-[ethyl(4-sulfobutyl)amino]anilino]methoxy]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 18335350 |
| Molecular Formula | C30H36N8O10S4 |
| Molecular Weight | 796.93 g/mol |
| Exact Mass | 796.14 |
| IUPAC Name | 5-[[2-[[3-tert-butyl-4-cyano-1-(1,3-thiazol-2-yl)pyrazol-5-yl]diazenyl]-5-[ethyl(4-sulfobutyl)amino]anilino]methoxy]benzene-1,3-disulfonic acid |
| SMILES | CCN(CCCCS(=O)(=O)O)c1ccc(/N=N\c2c(C#N)c(C(C)(C)C)nn2-c2nccs2)c(NCOc2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2)c1 |
| InChI | InChI=1S/C30H36N8O10S4/c1-5-37(11-6-7-13-50(39,40)41)20-8-9-25(34-35-28-24(18-31)27(30(2,3)4)36-38(28)29-32-10-12-49-29)26(14-20)33-19-48-21-15-22(51(42,43)44)17-23(16-21)52(45,46)47/h8-10,12,14-17,33H,5-7,11,13,19H2,1-4H3,(H,39,40,41)(H,42,43,44)(H,45,46,47)/b35-34- |
| InChIKey | LDKXEKMLOAIYPL-KNWKATPGSA-N |
| XLogP | 5.35 |
| TPSA | 266.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.93 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|