C24H25Cl2N7O7S2 — CID 23385944
4-[5-[[2-acetamido-4-[ethyl(4-sulfobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-2,5-dichlorobenzenesulfonic acid (PubChem CID 23385944) has the molecular formula C24H25Cl2N7O7S2 and a molecular weight of 658.55 g/mol. Its IUPAC name is 4-[5-[[2-acetamido-4-[ethyl(4-sulfobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-2,5-dichlorobenzenesulfonic acid.
| Compound Name | 4-[5-[[2-acetamido-4-[ethyl(4-sulfobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-2,5-dichlorobenzenesulfonic acid |
|---|---|
| PubChem CID | 23385944 |
| Molecular Formula | C24H25Cl2N7O7S2 |
| Molecular Weight | 658.55 g/mol |
| Exact Mass | 657.06 |
| IUPAC Name | 4-[5-[[2-acetamido-4-[ethyl(4-sulfobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-2,5-dichlorobenzenesulfonic acid |
| SMILES | CCN(CCCCS(=O)(=O)O)c1ccc(/N=N/c2c(C#N)cnn2-c2cc(Cl)c(S(=O)(=O)O)cc2Cl)c(NC(C)=O)c1 |
| InChI | InChI=1S/C24H25Cl2N7O7S2/c1-3-32(8-4-5-9-41(35,36)37)17-6-7-20(21(10-17)29-15(2)34)30-31-24-16(13-27)14-28-33(24)22-11-19(26)23(12-18(22)25)42(38,39)40/h6-7,10-12,14H,3-5,8-9H2,1-2H3,(H,29,34)(H,35,36,37)(H,38,39,40)/b31-30+ |
| InChIKey | KTTSKVXENGEGFO-NVQSTNCTSA-N |
| XLogP | 5.17 |
| TPSA | 207.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|