C19H13Cl3N6O5S — CID 135421374
2,5-dichloro-4-[5-[[3-chloro-4-hydroxy-5-(propanoylamino)phenyl]diazenyl]-4-cyanopyrazol-1-yl]benzenesulfonic acid (PubChem CID 135421374) has the molecular formula C19H13Cl3N6O5S and a molecular weight of 543.78 g/mol. Its IUPAC name is 2,5-dichloro-4-[5-[[3-chloro-4-hydroxy-5-(propanoylamino)phenyl]diazenyl]-4-cyanopyrazol-1-yl]benzenesulfonic acid.
| Compound Name | 2,5-dichloro-4-[5-[[3-chloro-4-hydroxy-5-(propanoylamino)phenyl]diazenyl]-4-cyanopyrazol-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135421374 |
| Molecular Formula | C19H13Cl3N6O5S |
| Molecular Weight | 543.78 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | 2,5-dichloro-4-[5-[[3-chloro-4-hydroxy-5-(propanoylamino)phenyl]diazenyl]-4-cyanopyrazol-1-yl]benzenesulfonic acid |
| SMILES | CCC(=O)Nc1cc(/N=N/c2c(C#N)cnn2-c2cc(Cl)c(S(=O)(=O)O)cc2Cl)cc(Cl)c1O |
| InChI | InChI=1S/C19H13Cl3N6O5S/c1-2-17(29)25-14-4-10(3-13(22)18(14)30)26-27-19-9(7-23)8-24-28(19)15-5-12(21)16(6-11(15)20)34(31,32)33/h3-6,8,30H,2H2,1H3,(H,25,29)(H,31,32,33)/b27-26+ |
| InChIKey | YNRZMOZIBPEMTH-CYYJNZCTSA-N |
| XLogP | 5.42 |
| TPSA | 170.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.78 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|