C11H11ClKN3O4 — CID 168726153
potassium 4-[3-chloro-2-hydroxy-5-(methyldiazenyl)anilino]-4-oxobutanoate (PubChem CID 168726153) has the molecular formula C11H11ClKN3O4 and a molecular weight of 323.78 g/mol. Its IUPAC name is potassium 4-[3-chloro-2-hydroxy-5-(methyldiazenyl)anilino]-4-oxobutanoate.
| Compound Name | potassium 4-[3-chloro-2-hydroxy-5-(methyldiazenyl)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 168726153 |
| Molecular Formula | C11H11ClKN3O4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | potassium 4-[3-chloro-2-hydroxy-5-(methyldiazenyl)anilino]-4-oxobutanoate |
| SMILES | C/N=N/c1cc(Cl)c(O)c(NC(=O)CCC(=O)[O-])c1.[K+] |
| InChI | InChI=1S/C11H12ClN3O4.K/c1-13-15-6-4-7(12)11(19)8(5-6)14-9(16)2-3-10(17)18;/h4-5,19H,2-3H2,1H3,(H,14,16)(H,17,18);/q;+1/p-1/b15-13+; |
| InChIKey | JIEAHHPOOCGYTK-GVYCEHEKSA-M |
| XLogP | -1.77 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|