C23H22Cl2N7NaO4S — CID 59944720
sodium 2,5-dichloro-4-[4-cyano-5-[[4-[ethyl(methyl)amino]-2-(propanoylamino)phenyl]diazenyl]-3-methylpyrazol-1-yl]benzenesulfonate (PubChem CID 59944720) has the molecular formula C23H22Cl2N7NaO4S and a molecular weight of 586.44 g/mol. Its IUPAC name is sodium 2,5-dichloro-4-[4-cyano-5-[[4-[ethyl(methyl)amino]-2-(propanoylamino)phenyl]diazenyl]-3-methylpyrazol-1-yl]benzenesulfonate.
| Compound Name | sodium 2,5-dichloro-4-[4-cyano-5-[[4-[ethyl(methyl)amino]-2-(propanoylamino)phenyl]diazenyl]-3-methylpyrazol-1-yl]benzenesulfonate |
|---|---|
| PubChem CID | 59944720 |
| Molecular Formula | C23H22Cl2N7NaO4S |
| Molecular Weight | 586.44 g/mol |
| Exact Mass | 585.07 |
| IUPAC Name | sodium 2,5-dichloro-4-[4-cyano-5-[[4-[ethyl(methyl)amino]-2-(propanoylamino)phenyl]diazenyl]-3-methylpyrazol-1-yl]benzenesulfonate |
| SMILES | CCC(=O)Nc1cc(N(C)CC)ccc1/N=N/c1c(C#N)c(C)nn1-c1cc(Cl)c(S(=O)(=O)[O-])cc1Cl.[Na+] |
| InChI | InChI=1S/C23H23Cl2N7O4S.Na/c1-5-22(33)27-19-9-14(31(4)6-2)7-8-18(19)28-29-23-15(12-26)13(3)30-32(23)20-10-17(25)21(11-16(20)24)37(34,35)36;/h7-11H,5-6H2,1-4H3,(H,27,33)(H,34,35,36);/q;+1/p-1/b29-28+; |
| InChIKey | GRFLPRHMPJLEBB-IRWWKPKRSA-M |
| XLogP | 2.49 |
| TPSA | 155.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|