C21H19K2N7O7S2 — CID 59944756
dipotassium;3-[5-[[2-acetamido-4-(dimethylamino)phenyl]diazenyl]-4-cyano-3-methylpyrazol-1-yl]-5-oxidoperoxysulfanylbenzenesulfonate (PubChem CID 59944756) has the molecular formula C21H19K2N7O7S2 and a molecular weight of 623.76 g/mol. Its IUPAC name is dipotassium;3-[5-[[2-acetamido-4-(dimethylamino)phenyl]diazenyl]-4-cyano-3-methylpyrazol-1-yl]-5-oxidoperoxysulfanylbenzenesulfonate.
| Compound Name | dipotassium;3-[5-[[2-acetamido-4-(dimethylamino)phenyl]diazenyl]-4-cyano-3-methylpyrazol-1-yl]-5-oxidoperoxysulfanylbenzenesulfonate |
|---|---|
| PubChem CID | 59944756 |
| Molecular Formula | C21H19K2N7O7S2 |
| Molecular Weight | 623.76 g/mol |
| Exact Mass | 623.01 |
| IUPAC Name | dipotassium;3-[5-[[2-acetamido-4-(dimethylamino)phenyl]diazenyl]-4-cyano-3-methylpyrazol-1-yl]-5-oxidoperoxysulfanylbenzenesulfonate |
| SMILES | CC(=O)Nc1cc(N(C)C)ccc1/N=N/c1c(C#N)c(C)nn1-c1cc(SOO[O-])cc(S(=O)(=O)[O-])c1.[K+].[K+] |
| InChI | InChI=1S/C21H21N7O7S2.2K/c1-12-18(11-22)21(25-24-19-6-5-14(27(3)4)9-20(19)23-13(2)29)28(26-12)15-7-16(36-35-34-30)10-17(8-15)37(31,32)33;;/h5-10,30H,1-4H3,(H,23,29)(H,31,32,33);;/q;2*+1/p-2/b25-24+;; |
| InChIKey | ZZWTUHGJXJJZLG-JQCJJEDZSA-L |
| XLogP | -3.37 |
| TPSA | 197.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.76 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|