C22H24N8O7S2 — CID 59944695
3-[4-cyano-5-[[4-(dimethylamino)-2-(dimethylcarbamoylamino)phenyl]diazenyl]-3-methylpyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid (PubChem CID 59944695) has the molecular formula C22H24N8O7S2 and a molecular weight of 576.62 g/mol. Its IUPAC name is 3-[4-cyano-5-[[4-(dimethylamino)-2-(dimethylcarbamoylamino)phenyl]diazenyl]-3-methylpyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid.
| Compound Name | 3-[4-cyano-5-[[4-(dimethylamino)-2-(dimethylcarbamoylamino)phenyl]diazenyl]-3-methylpyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 59944695 |
| Molecular Formula | C22H24N8O7S2 |
| Molecular Weight | 576.62 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | 3-[4-cyano-5-[[4-(dimethylamino)-2-(dimethylcarbamoylamino)phenyl]diazenyl]-3-methylpyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid |
| SMILES | Cc1nn(-c2cc(S(=O)(=O)O)ccc2SOOO)c(/N=N/c2ccc(N(C)C)cc2NC(=O)N(C)C)c1C#N |
| InChI | InChI=1S/C22H24N8O7S2/c1-13-16(12-23)21(26-25-17-8-6-14(28(2)3)10-18(17)24-22(31)29(4)5)30(27-13)19-11-15(39(33,34)35)7-9-20(19)38-37-36-32/h6-11,32H,1-5H3,(H,24,31)(H,33,34,35)/b26-25+ |
| InChIKey | UTEXPJPOPLXGRV-OCEACIFDSA-N |
| XLogP | 4.30 |
| TPSA | 194.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|