C36H41ClN8O7S — CID 136715885
(2R)-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[3-chloro-5-[[4-cyano-1-(2-nitro-4-sulfamoylphenyl)pyrazol-5-yl]diazenyl]-2-hydroxyphenyl]butanamide (PubChem CID 136715885) has the molecular formula C36H41ClN8O7S and a molecular weight of 765.29 g/mol. Its IUPAC name is (2R)-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[3-chloro-5-[[4-cyano-1-(2-nitro-4-sulfamoylphenyl)pyrazol-5-yl]diazenyl]-2-hydroxyphenyl]butanamide.
| Compound Name | (2R)-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[3-chloro-5-[[4-cyano-1-(2-nitro-4-sulfamoylphenyl)pyrazol-5-yl]diazenyl]-2-hydroxyphenyl]butanamide |
|---|---|
| PubChem CID | 136715885 |
| Molecular Formula | C36H41ClN8O7S |
| Molecular Weight | 765.29 g/mol |
| Exact Mass | 764.25 |
| IUPAC Name | (2R)-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[3-chloro-5-[[4-cyano-1-(2-nitro-4-sulfamoylphenyl)pyrazol-5-yl]diazenyl]-2-hydroxyphenyl]butanamide |
| SMILES | CC[C@@H](Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1cc(/N=N/c2c(C#N)cnn2-c2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])cc(Cl)c1O |
| InChI | InChI=1S/C36H41ClN8O7S/c1-8-30(52-31-14-11-22(35(4,5)9-2)15-25(31)36(6,7)10-3)34(47)41-27-17-23(16-26(37)32(27)46)42-43-33-21(19-38)20-40-44(33)28-13-12-24(53(39,50)51)18-29(28)45(48)49/h11-18,20,30,46H,8-10H2,1-7H3,(H,41,47)(H2,39,50,51)/b43-42+/t30-/m1/s1 |
| InChIKey | NOLOTQDEHTWGHW-HVFSQBNHSA-N |
| XLogP | 8.25 |
| TPSA | 228.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.29 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|