C42H49N3O7S — CID 20559244
N-[3-[3-anilino-2-methoxy-2-(2-nitrophenyl)sulfanyl-3-oxopropanoyl]phenyl]-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide (PubChem CID 20559244) has the molecular formula C42H49N3O7S and a molecular weight of 739.94 g/mol. Its IUPAC name is N-[3-[3-anilino-2-methoxy-2-(2-nitrophenyl)sulfanyl-3-oxopropanoyl]phenyl]-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide.
| Compound Name | N-[3-[3-anilino-2-methoxy-2-(2-nitrophenyl)sulfanyl-3-oxopropanoyl]phenyl]-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide |
|---|---|
| PubChem CID | 20559244 |
| Molecular Formula | C42H49N3O7S |
| Molecular Weight | 739.94 g/mol |
| Exact Mass | 739.33 |
| IUPAC Name | N-[3-[3-anilino-2-methoxy-2-(2-nitrophenyl)sulfanyl-3-oxopropanoyl]phenyl]-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1cccc(C(=O)C(OC)(Sc2ccccc2[N+](=O)[O-])C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C42H49N3O7S/c1-9-34(52-35-25-24-29(40(4,5)10-2)27-32(35)41(6,7)11-3)38(47)43-31-21-17-18-28(26-31)37(46)42(51-8,39(48)44-30-19-13-12-14-20-30)53-36-23-16-15-22-33(36)45(49)50/h12-27,34H,9-11H2,1-8H3,(H,43,47)(H,44,48) |
| InChIKey | BCRNTZSTVBDRKX-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.94 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|