C37H58ClN4O5P — CID 88800596
2-[bis(dimethylamino)phosphanyloxy]-N-[3-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-2-chloro-4,4-dimethyl-3-oxopentanamide (PubChem CID 88800596) has the molecular formula C37H58ClN4O5P and a molecular weight of 705.32 g/mol. Its IUPAC name is 2-[bis(dimethylamino)phosphanyloxy]-N-[3-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-2-chloro-4,4-dimethyl-3-oxopentanamide.
| Compound Name | 2-[bis(dimethylamino)phosphanyloxy]-N-[3-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-2-chloro-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 88800596 |
| Molecular Formula | C37H58ClN4O5P |
| Molecular Weight | 705.32 g/mol |
| Exact Mass | 704.38 |
| IUPAC Name | 2-[bis(dimethylamino)phosphanyloxy]-N-[3-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-2-chloro-4,4-dimethyl-3-oxopentanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1cccc(NC(=O)C(Cl)(OP(N(C)C)N(C)C)C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C37H58ClN4O5P/c1-15-29(46-30-22-21-25(35(7,8)16-2)23-28(30)36(9,10)17-3)31(43)39-26-19-18-20-27(24-26)40-33(45)37(38,32(44)34(4,5)6)47-48(41(11)12)42(13)14/h18-24,29H,15-17H2,1-14H3,(H,39,43)(H,40,45) |
| InChIKey | IJDSXAGDEPIBQF-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.32 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|