C40H51ClN2O7 — CID 21436954
4-[1-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]anilino]-2-chloro-4,4-dimethyl-1,3-dioxopentan-2-yl]oxybenzoic acid (PubChem CID 21436954) has the molecular formula C40H51ClN2O7 and a molecular weight of 707.31 g/mol. Its IUPAC name is 4-[1-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]anilino]-2-chloro-4,4-dimethyl-1,3-dioxopentan-2-yl]oxybenzoic acid.
| Compound Name | 4-[1-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]anilino]-2-chloro-4,4-dimethyl-1,3-dioxopentan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 21436954 |
| Molecular Formula | C40H51ClN2O7 |
| Molecular Weight | 707.31 g/mol |
| Exact Mass | 706.34 |
| IUPAC Name | 4-[1-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]anilino]-2-chloro-4,4-dimethyl-1,3-dioxopentan-2-yl]oxybenzoic acid |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)Nc2cccc(NC(=O)C(Cl)(Oc3ccc(C(=O)O)cc3)C(=O)C(C)(C)C)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C40H51ClN2O7/c1-10-38(6,7)27-19-22-32(31(24-27)39(8,9)11-2)49-23-13-16-33(44)42-28-14-12-15-29(25-28)43-36(48)40(41,35(47)37(3,4)5)50-30-20-17-26(18-21-30)34(45)46/h12,14-15,17-22,24-25H,10-11,13,16,23H2,1-9H3,(H,42,44)(H,43,48)(H,45,46) |
| InChIKey | VOPSVBLYEASSGX-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.31 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|