C47H56ClN5O6 — CID 20553342
N-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-2-chloro-2-(3,5-dioxo-1,2-diphenyl-1,2,4-triazolidin-4-yl)-4,4-dimethyl-3-oxopentanamide (PubChem CID 20553342) has the molecular formula C47H56ClN5O6 and a molecular weight of 822.45 g/mol. Its IUPAC name is N-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-2-chloro-2-(3,5-dioxo-1,2-diphenyl-1,2,4-triazolidin-4-yl)-4,4-dimethyl-3-oxopentanamide.
| Compound Name | N-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-2-chloro-2-(3,5-dioxo-1,2-diphenyl-1,2,4-triazolidin-4-yl)-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 20553342 |
| Molecular Formula | C47H56ClN5O6 |
| Molecular Weight | 822.45 g/mol |
| Exact Mass | 821.39 |
| IUPAC Name | N-[3-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-2-chloro-2-(3,5-dioxo-1,2-diphenyl-1,2,4-triazolidin-4-yl)-4,4-dimethyl-3-oxopentanamide |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)Nc2cccc(NC(=O)C(Cl)(C(=O)C(C)(C)C)n3c(=O)n(-c4ccccc4)n(-c4ccccc4)c3=O)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C47H56ClN5O6/c1-10-45(6,7)32-27-28-38(37(30-32)46(8,9)11-2)59-29-19-26-39(54)49-33-20-18-21-34(31-33)50-41(56)47(48,40(55)44(3,4)5)51-42(57)52(35-22-14-12-15-23-35)53(43(51)58)36-24-16-13-17-25-36/h12-18,20-25,27-28,30-31H,10-11,19,26,29H2,1-9H3,(H,49,54)(H,50,56) |
| InChIKey | WJSIBHQNSYWDNN-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.45 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|