C28H28ClN5O4 — CID 20573971
N-(3-aminophenyl)-2-(1-benzyl-3,5-dioxo-2-phenyl-1,2,4-triazolidin-4-yl)-2-chloro-4,4-dimethyl-3-oxopentanamide (PubChem CID 20573971) has the molecular formula C28H28ClN5O4 and a molecular weight of 534.02 g/mol. Its IUPAC name is N-(3-aminophenyl)-2-(1-benzyl-3,5-dioxo-2-phenyl-1,2,4-triazolidin-4-yl)-2-chloro-4,4-dimethyl-3-oxopentanamide.
| Compound Name | N-(3-aminophenyl)-2-(1-benzyl-3,5-dioxo-2-phenyl-1,2,4-triazolidin-4-yl)-2-chloro-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 20573971 |
| Molecular Formula | C28H28ClN5O4 |
| Molecular Weight | 534.02 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | N-(3-aminophenyl)-2-(1-benzyl-3,5-dioxo-2-phenyl-1,2,4-triazolidin-4-yl)-2-chloro-4,4-dimethyl-3-oxopentanamide |
| SMILES | CC(C)(C)C(=O)C(Cl)(C(=O)Nc1cccc(N)c1)n1c(=O)n(Cc2ccccc2)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C28H28ClN5O4/c1-27(2,3)23(35)28(29,24(36)31-21-14-10-13-20(30)17-21)33-25(37)32(18-19-11-6-4-7-12-19)34(26(33)38)22-15-8-5-9-16-22/h4-17H,18,30H2,1-3H3,(H,31,36) |
| InChIKey | QJGKGOTZXVRQEA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.02 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|