C24H28Cl2N4O — CID 134281144
N-[3-[(2,7-diaminocarbazol-9-yl)methyl]phenyl]-2,2-dimethylpropanamide;dihydrochloride (PubChem CID 134281144) has the molecular formula C24H28Cl2N4O and a molecular weight of 459.42 g/mol. Its IUPAC name is N-[3-[(2,7-diaminocarbazol-9-yl)methyl]phenyl]-2,2-dimethylpropanamide;dihydrochloride.
| Compound Name | N-[3-[(2,7-diaminocarbazol-9-yl)methyl]phenyl]-2,2-dimethylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 134281144 |
| Molecular Formula | C24H28Cl2N4O |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-[3-[(2,7-diaminocarbazol-9-yl)methyl]phenyl]-2,2-dimethylpropanamide;dihydrochloride |
| SMILES | CC(C)(C)C(=O)Nc1cccc(Cn2c3cc(N)ccc3c3ccc(N)cc32)c1.Cl.Cl |
| InChI | InChI=1S/C24H26N4O.2ClH/c1-24(2,3)23(29)27-18-6-4-5-15(11-18)14-28-21-12-16(25)7-9-19(21)20-10-8-17(26)13-22(20)28;;/h4-13H,14,25-26H2,1-3H3,(H,27,29);2*1H |
| InChIKey | VVKNHHIEWVBIME-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|