C24H26N4O4 — CID 145024655
3-[[4-[4-amino-2-(2,2-dimethylpropanoylamino)phenyl]-2-methyl-6-oxopyrimidin-1-yl]methyl]benzoic acid (PubChem CID 145024655) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 3-[[4-[4-amino-2-(2,2-dimethylpropanoylamino)phenyl]-2-methyl-6-oxopyrimidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[4-[4-amino-2-(2,2-dimethylpropanoylamino)phenyl]-2-methyl-6-oxopyrimidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 145024655 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 3-[[4-[4-amino-2-(2,2-dimethylpropanoylamino)phenyl]-2-methyl-6-oxopyrimidin-1-yl]methyl]benzoic acid |
| SMILES | Cc1nc(-c2ccc(N)cc2NC(=O)C(C)(C)C)cc(=O)n1Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C24H26N4O4/c1-14-26-20(18-9-8-17(25)11-19(18)27-23(32)24(2,3)4)12-21(29)28(14)13-15-6-5-7-16(10-15)22(30)31/h5-12H,13,25H2,1-4H3,(H,27,32)(H,30,31) |
| InChIKey | SSKHOCFGUZHFRQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|