C10H9N3O4 — CID 107409441
3-[(3,5-dioxo-1,2,4-triazolidin-4-yl)methyl]benzoic acid (PubChem CID 107409441) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 3-[(3,5-dioxo-1,2,4-triazolidin-4-yl)methyl]benzoic acid.
| Compound Name | 3-[(3,5-dioxo-1,2,4-triazolidin-4-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 107409441 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 3-[(3,5-dioxo-1,2,4-triazolidin-4-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(Cn2c(=O)[nH][nH]c2=O)c1 |
| InChI | InChI=1S/C10H9N3O4/c14-8(15)7-3-1-2-6(4-7)5-13-9(16)11-12-10(13)17/h1-4H,5H2,(H,11,16)(H,12,17)(H,14,15) |
| InChIKey | UWWMTSPEXAQIIL-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |