C24H24F3N3O3 — CID 129198030
3-[[6-oxo-2-(pentylamino)-4-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]methyl]benzoic acid (PubChem CID 129198030) has the molecular formula C24H24F3N3O3 and a molecular weight of 459.47 g/mol. Its IUPAC name is 3-[[6-oxo-2-(pentylamino)-4-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[6-oxo-2-(pentylamino)-4-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 129198030 |
| Molecular Formula | C24H24F3N3O3 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 3-[[6-oxo-2-(pentylamino)-4-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]methyl]benzoic acid |
| SMILES | CCCCCNc1nc(-c2ccc(C(F)(F)F)cc2)cc(=O)n1Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C24H24F3N3O3/c1-2-3-4-12-28-23-29-20(17-8-10-19(11-9-17)24(25,26)27)14-21(31)30(23)15-16-6-5-7-18(13-16)22(32)33/h5-11,13-14H,2-4,12,15H2,1H3,(H,28,29)(H,32,33) |
| InChIKey | KDILPLISARXJGZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|