C16H15ClF3NO2 — CID 67186153
3-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]benzoic acid;hydrochloride (PubChem CID 67186153) has the molecular formula C16H15ClF3NO2 and a molecular weight of 345.75 g/mol. Its IUPAC name is 3-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]benzoic acid;hydrochloride.
| Compound Name | 3-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 67186153 |
| Molecular Formula | C16H15ClF3NO2 |
| Molecular Weight | 345.75 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 3-[[[4-(trifluoromethyl)phenyl]methylamino]methyl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1cccc(CNCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C16H14F3NO2.ClH/c17-16(18,19)14-6-4-11(5-7-14)9-20-10-12-2-1-3-13(8-12)15(21)22;/h1-8,20H,9-10H2,(H,21,22);1H |
| InChIKey | NCOSQXHQEMUYPZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.75 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |