C20H26ClN3O2 — CID 119780709
N-[3-[[2-(4-aminophenyl)acetyl]amino]-4-methylphenyl]-2,2-dimethylpropanamide;hydrochloride (PubChem CID 119780709) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is N-[3-[[2-(4-aminophenyl)acetyl]amino]-4-methylphenyl]-2,2-dimethylpropanamide;hydrochloride.
| Compound Name | N-[3-[[2-(4-aminophenyl)acetyl]amino]-4-methylphenyl]-2,2-dimethylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119780709 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-[3-[[2-(4-aminophenyl)acetyl]amino]-4-methylphenyl]-2,2-dimethylpropanamide;hydrochloride |
| SMILES | Cc1ccc(NC(=O)C(C)(C)C)cc1NC(=O)Cc1ccc(N)cc1.Cl |
| InChI | InChI=1S/C20H25N3O2.ClH/c1-13-5-10-16(22-19(25)20(2,3)4)12-17(13)23-18(24)11-14-6-8-15(21)9-7-14;/h5-10,12H,11,21H2,1-4H3,(H,22,25)(H,23,24);1H |
| InChIKey | ZWYTUHFPCXZLGG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|