C33H48ClFN2O3 — CID 88789212
5-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylamino]-2-chloro-2-fluoro-4,4-dimethyl-3-oxo-N-phenylpentanamide (PubChem CID 88789212) has the molecular formula C33H48ClFN2O3 and a molecular weight of 575.21 g/mol. Its IUPAC name is 5-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylamino]-2-chloro-2-fluoro-4,4-dimethyl-3-oxo-N-phenylpentanamide.
| Compound Name | 5-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylamino]-2-chloro-2-fluoro-4,4-dimethyl-3-oxo-N-phenylpentanamide |
|---|---|
| PubChem CID | 88789212 |
| Molecular Formula | C33H48ClFN2O3 |
| Molecular Weight | 575.21 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | 5-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylamino]-2-chloro-2-fluoro-4,4-dimethyl-3-oxo-N-phenylpentanamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNCC(C)(C)C(=O)C(F)(Cl)C(=O)Nc2ccccc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C33H48ClFN2O3/c1-9-30(3,4)24-18-19-27(26(22-24)31(5,6)10-2)40-21-15-14-20-36-23-32(7,8)28(38)33(34,35)29(39)37-25-16-12-11-13-17-25/h11-13,16-19,22,36H,9-10,14-15,20-21,23H2,1-8H3,(H,37,39) |
| InChIKey | AYNHNJZHCPIKNU-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.21 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|